| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:03 UTC |
|---|
| Update Date | 2025-03-21 17:59:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022147 |
|---|
| Frequency | 179.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8N2O3S |
|---|
| Molecular Mass | 188.0256 |
|---|
| SMILES | O=C(O)C(O)Cc1c[nH]c(=S)[nH]1 |
|---|
| InChI Key | VEUDAUKOXOLDES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolines |
|---|
| Subclass | imidazolines |
|---|
| Direct Parent | imidazolethiones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholsthioureas |
|---|
| Substituents | carbonyl groupthioureacarboxylic acidaromatic heteromonocyclic compoundalpha-hydroxy acidimidazole-2-thioneorganosulfur compoundcarboxylic acid derivativeorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundazolealcoholazacycleheteroaromatic compoundhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
