Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:43:08 UTC |
---|
Update Date | 2025-03-21 17:59:39 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00022341 |
---|
Frequency | 185.2 |
---|
Structure | |
---|
Chemical Formula | C18H21N7O5 |
---|
Molecular Mass | 415.1604 |
---|
SMILES | CC(NC(=O)c1ccc(NCC2CNc3[nH]c(N)nc(=O)c3N2C=O)cc1)C(=O)O |
---|
InChI Key | DIYVXMSBVVBFGJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | hippuric acids and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alanine and derivativesalpha amino acidsamino acidsazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminespterins and derivativespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidestertiary carboxylic acid amidesvinylogous amides |
---|
Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidbenzoylpyrimidonealpha-amino acid or derivativescarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesvinylogous amidepterinazacyclen-acyl-alpha-amino acidhippuric acid or derivativesheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundphenylalkylaminealanine or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
---|