| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:08 UTC |
|---|
| Update Date | 2025-03-21 17:59:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022343 |
|---|
| Frequency | 177.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11NO6S |
|---|
| Molecular Mass | 261.0307 |
|---|
| SMILES | CC(=O)Nc1ccc(OCOS(=O)(=O)O)cc1 |
|---|
| InChI Key | JQSUAFXHXHIXIL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoestercarbonyl groupn-acetylarylaminen-arylamidecarboxylic acid derivativeorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundacetamideorganic sulfuric acid or derivativesacetanilidecarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|