| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:09 UTC |
|---|
| Update Date | 2025-03-21 17:59:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022377 |
|---|
| Frequency | 177.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13NO2 |
|---|
| Molecular Mass | 215.0946 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)c1ccco1 |
|---|
| InChI Key | JHKXLXFJRVUZRH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | 2-furanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidescarboxylic acids and derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | furanaromatic heteromonocyclic compoundcarboxylic acid derivative2-heteroaryl carboxamidexyleneorganic oxide2-furanilideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundfuroic acid or derivativesheteroaromatic compoundm-xylenecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
