| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:43:11 UTC |
|---|
| Update Date | 2025-03-21 17:59:40 UTC |
|---|
| HMDB ID | HMDB0253945 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022452 |
|---|
| Name | Lactobionic acid |
|---|
| Frequency | 176.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H22O12 |
|---|
| Molecular Mass | 358.1111 |
|---|
| SMILES | O=C(O)C(O)C(O)C(OC1OC(CO)C(O)C(O)C1O)C(O)CO |
|---|
| InChI Key | JYTUSYBCFIZPBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidheterocyclic fatty acidalpha-hydroxy acidmonosaccharidefatty acidcarboxylic acid derivativemedium-chain hydroxy acidbeta-hydroxy acidsaccharideorganic oxideacetalaliphatic heteromonocyclic compoundmedium-chain fatty acidhydroxy fatty acidoxaneprimary alcoholorganoheterocyclic compoundalcoholhydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativesaccharolipidorganooxygen compound |
|---|
