| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:43:13 UTC |
|---|
| Update Date | 2025-03-21 17:59:40 UTC |
|---|
| HMDB ID | HMDB0136090 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022498 |
|---|
| Name | 2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,4,5,7-tetrol |
|---|
| Frequency | 176.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O8 |
|---|
| Molecular Mass | 322.0689 |
|---|
| SMILES | Oc1cc(O)c2c(c1)OC(c1cc(O)c(O)c(O)c1)C(O)C2O |
|---|
| InChI Key | ZEACOKJOQLAYTD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | epigallocatechins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-hydroxyflavonoids4'-hydroxyflavonoids4-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesleucoanthocyanidinsoxacyclic compoundspyrogallols and derivativessecondary alcohols |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl ether4-hydroxyflavonoidaromatic heteropolycyclic compoundleucoanthocyanidin-skeletonchromaneorganoheterocyclic compound1,2-diolalcoholbenzopyranpyrogallol derivativebenzenetriol5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidepigallocatechinorganooxygen compound |
|---|