| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:16 UTC |
|---|
| Update Date | 2025-03-21 17:59:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022618 |
|---|
| Frequency | 175.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H47N2O+ |
|---|
| Molecular Mass | 367.3683 |
|---|
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCC[N+](C)(C)C |
|---|
| InChI Key | DAJJORSFPYNZPN-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | n-acyl amines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouptetraalkylammonium saltquaternary ammonium saltcarboxamide groupcarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|