| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:19 UTC |
|---|
| Update Date | 2025-03-21 17:59:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022743 |
|---|
| Frequency | 173.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O12 |
|---|
| Molecular Mass | 464.0955 |
|---|
| SMILES | O=C1c2c(O)cc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2OCC1c1ccc(O)c(O)c1 |
|---|
| InChI Key | ABUSJWJPZCHYAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavonoid o-glycosides |
|---|
| Direct Parent | isoflavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativesbeta hydroxy acids and derivativescarboxylic acidschromonesglucuronic acid derivativeshydrocarbon derivativesisoflavanolsisoflavanonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyrano-glucuronidemonosaccharidepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidsaccharideacetalchromoneoxaneorganoheterocyclic compoundalcoholisoflavanbenzopyranvinylogous acidphenolhydrocarbon derivativearyl ketonecarbonyl groupetherglucuronic acid or derivativesisoflavanol1-hydroxy-2-unsubstituted benzenoidisoflavonoid-7-o-glycosidealkyl aryl ethercarboxylic acid derivativeisoflavanoneorganic oxidearomatic heteropolycyclic compoundchromanepyran carboxylic acid or derivativesisoflavonoid o-glycosidehydroxy acid1-hydroxy-4-unsubstituted benzenoidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholbenzenoidorganooxygen compound |
|---|