| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:20 UTC |
|---|
| Update Date | 2025-03-21 17:59:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022750 |
|---|
| Frequency | 173.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20O |
|---|
| Molecular Mass | 204.1514 |
|---|
| SMILES | Cc1ccc(C)c(CC(=O)C(C)C)c1C |
|---|
| InChI Key | YRLQIVQPMSSRPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | ketonearomatic homomonocyclic compoundmonocyclic benzene moietycarbonyl grouporganic oxideorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|