| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:20 UTC |
|---|
| Update Date | 2025-03-21 17:59:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022752 |
|---|
| Frequency | 173.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO2 |
|---|
| Molecular Mass | 283.1572 |
|---|
| SMILES | COc1cc2c(cc1O)C(Cc1ccccc1)N(C)CC2 |
|---|
| InChI Key | TXBIVOUMLHWHLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | benzylisoquinolines |
|---|
| Direct Parent | benzylisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaralkylaminesazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesorganopnictogen compoundstetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherazacycletertiary aliphatic amine1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherbenzylisoquinolinearalkylamineorganic oxygen compoundaromatic heteropolycyclic compoundanisoleorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
