| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:24 UTC |
|---|
| Update Date | 2025-03-21 17:59:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00022909 |
|---|
| Frequency | 172.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N3O |
|---|
| Molecular Mass | 233.1528 |
|---|
| SMILES | CC(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
|---|
| InChI Key | QAEVFGOUSCYAPU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-acetylarylaminesn-arylpiperazinesn-methylpiperazinesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesn-arylamidecarboxylic acid derivativeorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamideazacycleacetanilideaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminen-methylpiperazinecarboxamide groupphenylpiperazineanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
