| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:28 UTC |
|---|
| Update Date | 2025-03-21 17:59:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023057 |
|---|
| Frequency | 171.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N3O4 |
|---|
| Molecular Mass | 227.0906 |
|---|
| SMILES | N=c1ccn(C2OC(CO)C(O)C2O)cn1 |
|---|
| InChI Key | OAQQESRINGHYFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholaromatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharidepyrimidineoxacyclesaccharideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativepyrimidine nucleosideorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
