| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:43:29 UTC |
|---|
| Update Date | 2025-03-21 17:59:46 UTC |
|---|
| HMDB ID | HMDB0129972 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023080 |
|---|
| Name | [4-(5,7-dihydroxy-4-oxo-4H-chromen-3-yl)phenyl]oxidanesulfonic acid |
|---|
| Frequency | 170.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O8S |
|---|
| Molecular Mass | 350.0096 |
|---|
| SMILES | O=c1c(-c2ccc(OS(=O)(=O)O)cc2)coc2cc(O)cc(O)c12 |
|---|
| InChI Key | KIWWRRLFZKBEAL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundsphenoxy compoundsphenylsulfatespyranones and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoester1-benzopyran1-hydroxy-2-unsubstituted benzenoidphenylsulfateorganic oxidechromonearomatic heteropolycyclic compoundpyranonearylsulfateorganoheterocyclic compoundisoflavonebenzopyranorganic sulfuric acid or derivativesheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyransulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
