Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:43:33 UTC |
---|
Update Date | 2025-03-21 17:59:47 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00023243 |
---|
Frequency | 169.4 |
---|
Structure | |
---|
Chemical Formula | C13H19NO5 |
---|
Molecular Mass | 269.1263 |
---|
SMILES | CCN(CC)CCOC(=O)c1cc(O)c(O)c(O)c1 |
---|
InChI Key | WQHIPZSARJRHGH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | m-hydroxybenzoic acid esters |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundspyrogallols and derivativestrialkylaminesp-hydroxybenzoic acid alkyl esters |
---|
Substituents | amino acid or derivativesp-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundm-hydroxybenzoic acid estertertiary aminepyrogallol derivativebenzenetrioltertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidp-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
---|