| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:35 UTC |
|---|
| Update Date | 2025-03-21 17:59:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023335 |
|---|
| Frequency | 168.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9BrCl2O2 |
|---|
| Molecular Mass | 309.9163 |
|---|
| SMILES | CC(=O)OC(c1ccccc1)C(Cl)(Cl)Br |
|---|
| InChI Key | QWBXEZGJUIMDNP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl bromidesalkyl chloridescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganobromidesorganochlorides |
|---|
| Substituents | benzyloxycarbonylcarbonyl groupalkyl chlorideorganochloridecarboxylic acid derivativeorganohalogen compoundalkyl bromidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterorganobromidealkyl halidehydrocarbon derivativeorganooxygen compound |
|---|