| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:35 UTC |
|---|
| Update Date | 2025-03-21 17:59:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023344 |
|---|
| Frequency | 168.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H30N2O2 |
|---|
| Molecular Mass | 366.2307 |
|---|
| SMILES | CC(=O)NCCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | NDZIJIOWKOCDJG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundspiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundacetamidealcoholazacycletertiary aliphatic aminecarboxamide groupsecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|