| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:43:36 UTC |
|---|
| Update Date | 2025-03-21 17:59:48 UTC |
|---|
| HMDB ID | HMDB0031665 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023384 |
|---|
| Name | Daucic acid |
|---|
| Frequency | 168.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O7 |
|---|
| Molecular Mass | 204.027 |
|---|
| SMILES | O=C(O)C1=CC(O)C(O)C(C(=O)O)O1 |
|---|
| InChI Key | KUKCUROTFRBUNU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativeshydroxy acidcarboxylic acid derivativeoxacyclebeta-hydroxy acidorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound1,2-diol |
|---|
