| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:38 UTC |
|---|
| Update Date | 2025-03-21 17:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023438 |
|---|
| Frequency | 167.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N5O6P |
|---|
| Molecular Mass | 317.0525 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C1OP(=O)(O)O |
|---|
| InChI Key | FVJFKNCAFCXALV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxetanesprimary alcoholsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | pyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamazolen-substituted imidazolealcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphateoxetanehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
