Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:43:39 UTC |
---|
Update Date | 2025-03-21 17:59:49 UTC |
---|
HMDB ID | HMDB0130183 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00023478 |
---|
Name | 3-(4-hydroxyphenyl)-1-(2,3,4,6-tetrahydroxyphenyl)propan-1-one |
---|
Frequency | 167.4 |
---|
Structure | |
---|
Chemical Formula | C15H14O6 |
---|
Molecular Mass | 290.079 |
---|
SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)c(O)c1O |
---|
InChI Key | UGFPFMCXXVIOGA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | linear 1,3-diarylpropanoids |
---|
Subclass | chalcones and dihydrochalcones |
---|
Direct Parent | 2'-hydroxy-dihydrochalcones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesorganooxygen compoundsvinylogous acids |
---|
Substituents | monocyclic benzene moiety2'-hydroxy-dihydrochalconearyl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolketonephloroglucinol derivativeorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidphenylketonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
---|