| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:39 UTC |
|---|
| Update Date | 2025-03-21 17:59:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023498 |
|---|
| Frequency | 167.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10N2O2 |
|---|
| Molecular Mass | 214.0742 |
|---|
| SMILES | O=C(Nc1ccc(O)cc1)c1cccnc1 |
|---|
| InChI Key | PUFQPHQEWBTFSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesnicotinamidesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyridinecarboxylic acids and derivativessecondary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundazacyclenicotinamideheteroaromatic compoundhydroxypyridine1-hydroxy-2-unsubstituted benzenoidcarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amidearomatic anilideorganic oxidepyridineorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
