| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:43:40 UTC |
|---|
| Update Date | 2025-03-21 17:59:49 UTC |
|---|
| HMDB ID | HMDB0001376 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023502 |
|---|
| Name | 2-Keto-3-deoxy-6-phosphogluconic acid |
|---|
| Frequency | 167.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O9P |
|---|
| Molecular Mass | 258.0141 |
|---|
| SMILES | O=C(O)C(=O)CC(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | OVPRPPOVAXRCED-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | medium-chain keto acids and derivatives |
|---|
| Direct Parent | medium-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha-hydroxy ketonesalpha-keto acids and derivativesbeta-hydroxy ketonescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidmonosaccharidealpha-hydroxy ketonecarboxylic acid derivativeketonesaccharideorganic oxidealpha-keto acid1,2-diolalcoholmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundmedium-chain keto acid |
|---|
