| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:44 UTC |
|---|
| Update Date | 2025-03-21 17:59:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023651 |
|---|
| Frequency | 166.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O5 |
|---|
| Molecular Mass | 220.0372 |
|---|
| SMILES | O=c1ccoc(-c2ccc(O)c(O)c2)c1O |
|---|
| InChI Key | WULHBWJOIBGRFT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | pyranones and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescyclic ketonesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcyclic ketone1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundpyranonephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|