| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:45 UTC |
|---|
| Update Date | 2025-03-21 17:59:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023692 |
|---|
| Frequency | 171.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N2O2 |
|---|
| Molecular Mass | 206.1055 |
|---|
| SMILES | CC(=O)NC(=O)C(N)Cc1ccccc1 |
|---|
| InChI Key | NUPDDTQMGFCFGB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesmonoalkylaminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupalpha-amino acid amidecarboxylic acid imidearomatic homomonocyclic compoundcarboxylic acid imide, n-unsubstitutedorganic oxidephenylalanine or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aliphatic aminedicarboximideorganic nitrogen compoundacetamideorganooxygen compoundamphetamine or derivatives |
|---|
