| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:47 UTC |
|---|
| Update Date | 2025-03-21 17:59:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023776 |
|---|
| Frequency | 164.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8Cl2O4 |
|---|
| Molecular Mass | 249.98 |
|---|
| SMILES | O=C(O)C(O)COc1ccc(Cl)cc1Cl |
|---|
| InChI Key | DQZUVZREOQEJNN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesaryl chloridescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesphenol ethersphenoxy compoundssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidorganochloridealpha-hydroxy acidmonosaccharidealkyl aryl ethercarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzenesaccharideorganic oxideglyceric_acidaryl chloridealcoholhydroxy acidaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
