Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:43:47 UTC |
---|
Update Date | 2025-03-21 17:59:52 UTC |
---|
HMDB ID | HMDB0031182 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00023779 |
---|
Name | Indole-3-acetyl-myo-inositol |
---|
Frequency | 164.7 |
---|
Structure | |
---|
Chemical Formula | C16H19NO7 |
---|
Molecular Mass | 337.1162 |
---|
SMILES | O=C(Cc1c[nH]c2ccccc12)OC1C(O)C(O)C(O)C(O)C1O |
---|
InChI Key | XUACNUJFOIKYPQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | indoles and derivatives |
---|
Subclass | indoles |
---|
Direct Parent | indoles |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acid esterscyclitols and derivativescyclohexanolsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
---|
Substituents | carbonyl groupindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholazacycleheteroaromatic compoundcyclohexanolcyclitol or derivativescyclic alcoholmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|