| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:50 UTC |
|---|
| Update Date | 2025-03-21 17:59:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00023909 |
|---|
| Frequency | 163.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19N2O11P |
|---|
| Molecular Mass | 374.0726 |
|---|
| SMILES | NC(CC(=O)NC1C(OP(=O)(O)O)OC(CO)C(O)C1O)C(=O)O |
|---|
| InChI Key | VHBRDOZHLZCTFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsasparagine and derivativescarbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesmonoalkyl phosphatesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesn-acyl aminesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidesshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidfatty amidemonosaccharidefatty acidalpha-amino acid or derivativescarboxylic acid derivativen-acyl-alpha-hexosamineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundasparagine or derivativesoxaneprimary alcoholorganoheterocyclic compoundalcoholcarboxamide groupn-acyl-amineacylaminosugaroxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
