Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:43:51 UTC |
---|
Update Date | 2025-03-21 17:59:54 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00023942 |
---|
Frequency | 163.4 |
---|
Structure | |
---|
Chemical Formula | C9H9NO6S |
---|
Molecular Mass | 259.0151 |
---|
SMILES | Nc1ccccc1C(=O)CC(=O)OS(=O)(=O)O |
---|
InChI Key | LFUJURGQNHSYGL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbonyl compounds |
---|
Direct Parent | alkyl-phenylketones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | amino acids and derivativesaryl alkyl ketonesbenzoyl derivativesbeta-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminessulfuric acid monoestersvinylogous amides |
---|
Substituents | monocyclic benzene moietysulfuric acid monoesteraryl alkyl ketoneamino acid or derivativesbenzoylcarboxylic acid derivativebeta-keto acidorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amideorganic sulfuric acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativesketo acidhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundsulfuric acid esteraminealkyl-phenylketone |
---|