| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:54 UTC |
|---|
| Update Date | 2025-03-21 17:59:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024066 |
|---|
| Frequency | 162.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H24N2O |
|---|
| Molecular Mass | 248.1889 |
|---|
| SMILES | CCN(CC)CC(=O)Nc1c(C)ccc(C)c1C |
|---|
| InChI Key | JUQHXWWUIDTRCX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsanilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupalpha-amino acid amidetertiary aliphatic aminen-arylamidecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
