| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:55 UTC |
|---|
| Update Date | 2025-03-21 17:59:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024098 |
|---|
| Frequency | 162.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N2O8P |
|---|
| Molecular Mass | 306.0253 |
|---|
| SMILES | O=c1ccn(C2OP(=O)(O)OC3C(CO)OC32)c(=O)[nH]1 |
|---|
| InChI Key | LXFYPLRPUJJUNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary alcoholsvinylogous amides |
|---|
| Substituents | alcoholvinylogous amideethercarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonedialkyl etheroxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundoxetaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganic phosphoric acid derivativeorganooxygen compound |
|---|
