| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:57 UTC |
|---|
| Update Date | 2025-03-21 17:59:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024168 |
|---|
| Frequency | 161.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14N2O2S |
|---|
| Molecular Mass | 298.0776 |
|---|
| SMILES | NS(=O)(=O)c1cccc2cccc(Nc3ccccc3)c12 |
|---|
| InChI Key | FTCGJKYYLVCUCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonamidesaminosulfonyl compoundsbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidessecondary amines |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyaminosulfonyl compoundaromatic homopolycyclic compoundnaphthalene sulfonamidesecondary amineorganosulfur compound1-naphthalene sulfonic acid or derivativesorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound1-naphthalene sulfonamideamine |
|---|
