Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:43:57 UTC |
---|
Update Date | 2025-03-21 17:59:56 UTC |
---|
HMDB ID | HMDB0140969 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00024180 |
---|
Name | 2-[4-(2-methylprop-2-en-1-yl)phenyl]propanoic acid |
---|
Frequency | 161.6 |
---|
Structure | |
---|
Chemical Formula | C13H16O2 |
---|
Molecular Mass | 204.115 |
---|
SMILES | C=C(C)Cc1ccc(C(C)C(=O)O)cc1 |
---|
InChI Key | QXHUNSIVQWFRQU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | phenylpropanoic acids |
---|
Subclass | phenylpropanoic acids |
---|
Direct Parent | phenylpropanoic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | aromatic monoterpenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenylpropanes |
---|
Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidp-cymenecarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativebenzenoidorganooxygen compoundaromatic monoterpenoid |
---|