| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:43:58 UTC |
|---|
| Update Date | 2025-03-21 17:59:56 UTC |
|---|
| HMDB ID | HMDB0029559 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024207 |
|---|
| Name | (4-Hydroxybenzoyl)choline |
|---|
| Frequency | 161.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18NO3+ |
|---|
| Molecular Mass | 224.1281 |
|---|
| SMILES | C[N+](C)(C)CCOC(=O)c1ccc(O)cc1 |
|---|
| InChI Key | BAPAICNRGIBFJT-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-hydroxybenzoic acid alkyl esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminesbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | benzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic salttetraalkylammonium saltquaternary ammonium saltp-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
