| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:43:59 UTC |
|---|
| Update Date | 2025-03-21 17:59:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024264 |
|---|
| Frequency | 160.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N2O4S |
|---|
| Molecular Mass | 230.0361 |
|---|
| SMILES | NC(=O)Cc1ccc(OS(N)(=O)=O)cc1 |
|---|
| InChI Key | XYYRJFVDPYFRNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl grouporganic sulfuric acid or derivativescarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundphenylacetamideorganooxygen compound |
|---|