| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:02 UTC |
|---|
| Update Date | 2025-03-21 17:59:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024379 |
|---|
| Frequency | 160.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O5 |
|---|
| Molecular Mass | 272.0685 |
|---|
| SMILES | O=C(O)C(=O)Cc1ccc(Oc2ccc(O)cc2)cc1 |
|---|
| InChI Key | MGRKYKREUWJEFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidsdiarylethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol ethersphenoxy compoundsphenylpropanoic acidsphenylpyruvic acid derivatives |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acid3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoidalpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxidealpha-keto acidphenylpyruvatearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundketo acidphenolhydrocarbon derivativephenoxy compounddiphenyletherorganooxygen compound |
|---|
