| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:44:05 UTC |
|---|
| Update Date | 2025-03-21 17:59:59 UTC |
|---|
| HMDB ID | HMDB0029438 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024498 |
|---|
| Name | L-Phosphoarginine |
|---|
| Frequency | 166.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H15N4O5P |
|---|
| Molecular Mass | 254.078 |
|---|
| SMILES | N=C(NCCCC(N)C(=O)O)NP(=O)(O)O |
|---|
| InChI Key | CCTIOCVIZPCTGO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboximidamidescarboxylic acidsfatty acids and conjugatesguanidineshydrocarbon derivativesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineiminefatty acidcarboximidamideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundarginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
