| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:09 UTC |
|---|
| Update Date | 2025-03-21 18:00:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024672 |
|---|
| Frequency | 157.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO |
|---|
| Molecular Mass | 253.1467 |
|---|
| SMILES | CN(C)C(=O)C(C)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | IUCYCSQBPZMNMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidestertiary carboxylic acid amides |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenylacetamideorganooxygen compound |
|---|
