| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:10 UTC |
|---|
| Update Date | 2025-03-21 18:00:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024687 |
|---|
| Frequency | 157.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H19NO7P+ |
|---|
| Molecular Mass | 272.0894 |
|---|
| SMILES | C[N+](C)(C)CCOP(=O)(O)OCC(O)C(=O)O |
|---|
| InChI Key | CCTQQKDNRDBZJY-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaminescarbonyl compoundscarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary alcoholssugar acids and derivativestetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideglyceric_acidorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium salthydroxy acidphosphocholinedialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|