| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:44:12 UTC |
|---|
| Update Date | 2025-03-21 18:00:02 UTC |
|---|
| HMDB ID | HMDB0253801 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00024780 |
|---|
| Name | Kinetin riboside |
|---|
| Frequency | 156.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17N5O5 |
|---|
| Molecular Mass | 347.123 |
|---|
| SMILES | OCC1OC(n2cnc3c(NCc4ccco4)ncnc32)C(O)C1O |
|---|
| InChI Key | CAGLGYNQQSIUGX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsfuransheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | furanmonosaccharideimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compoundamine |
|---|
