| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:18 UTC |
|---|
| Update Date | 2025-03-21 18:00:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025003 |
|---|
| Frequency | 154.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19N5O5 |
|---|
| Molecular Mass | 289.1386 |
|---|
| SMILES | N=C(NCCCC(N)C(=O)O)NC(CC(N)=O)C(=O)O |
|---|
| InChI Key | ABINITOTAYMINZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsasparagine and derivativescarbonyl compoundscarboximidamidescarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugatesfatty amidesguanidineshydrocarbon derivativesiminesmonoalkylaminesorganic oxidesorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidefatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineiminefatty amidefatty acidorganic oxidearginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundasparagine or derivativescarboximidamidecarboxamide grouporganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
