| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:18 UTC |
|---|
| Update Date | 2025-03-21 18:00:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025010 |
|---|
| Frequency | 163.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H11NO3 |
|---|
| Molecular Mass | 229.0739 |
|---|
| SMILES | O=C(O)CNC(=O)c1cccc2ccccc12 |
|---|
| InChI Key | YQHPVWRRSORYIV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenecarboxamidesnaphthalenecarboxylic acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acid1-naphthalenecarboxylic acid1-naphthalenecarboxamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundaromatic homopolycyclic compoundcarboxamide groupn-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compound1-naphthalenecarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
