Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:44:18 UTC |
---|
Update Date | 2025-03-21 18:00:05 UTC |
---|
HMDB ID | HMDB0136758 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00025024 |
---|
Name | 5,7-dihydroxy-4-methyl-2H-chromen-2-one |
---|
Frequency | 154.7 |
---|
Structure | |
---|
Chemical Formula | C10H8O4 |
---|
Molecular Mass | 192.0423 |
---|
SMILES | Cc1cc(=O)oc2cc(O)cc(O)c12 |
---|
InChI Key | QNVWGEJMXOQQPM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | coumarins and derivatives |
---|
Subclass | hydroxycoumarins |
---|
Direct Parent | 7-hydroxycoumarins |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzenoidscoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
---|
Substituents | benzopyran7-hydroxycoumarin1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|