| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:21 UTC |
|---|
| Update Date | 2025-03-21 18:00:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025112 |
|---|
| Frequency | 154.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | O=C(O)c1ccccc1OC(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | MRQPYGZWCDZHHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoic acid estersbenzoic acidsbenzoyl derivativescarboxylic acid estershydrocarbon derivativesorganic oxidesorganooxygen compoundsphenol estersphenoxy compoundstricarboxylic acids and derivatives |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidbenzoylbenzoic acid or derivativestricarboxylic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterphenol esterhydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundbenzoic acidphenoxy compoundorganooxygen compounddepside backbone |
|---|
