| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:21 UTC |
|---|
| Update Date | 2025-03-21 18:00:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025149 |
|---|
| Frequency | 159.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17N7O3 |
|---|
| Molecular Mass | 343.1393 |
|---|
| SMILES | NC(=O)c1ccc(NCC2CNc3[nH]c(N)nc(=O)c3N2C=O)cc1 |
|---|
| InChI Key | TVIQUFQSOZHDBR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminesprimary carboxylic acid amidespyrimidonessecondary alkylarylaminestertiary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietycarbonyl groupamino acid or derivativesbenzoylpyrimidonecarboxylic acid derivativebenzamidepyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundvinylogous amidepterinazacycleheteroaromatic compoundbenzoic acid or derivativessecondary aminecarboxamide groupsecondary aliphatic/aromatic amineorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
