| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:29 UTC |
|---|
| Update Date | 2025-03-21 18:00:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025435 |
|---|
| Frequency | 151.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N5O6P |
|---|
| Molecular Mass | 315.0369 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OOC2COP(=O)(O)OC21 |
|---|
| InChI Key | DXXALZQDEFKFTB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-dioxolanesazacyclic compoundsdialkyl peroxidesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | pyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoledialkyl peroxideorganonitrogen compoundorganopnictogen compoundimidolactamortho-dioxolaneazolen-substituted imidazoleazacycleheteroaromatic compoundoxacycleorganic oxygen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
