Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:44:31 UTC |
---|
Update Date | 2025-03-21 18:00:09 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00025512 |
---|
Frequency | 151.3 |
---|
Structure | |
---|
Chemical Formula | C18H22N2O11 |
---|
Molecular Mass | 442.1224 |
---|
SMILES | O=C(O)CCC(NC(=O)c1ccc(NC2OC(C(=O)O)C(O)C(O)C2O)cc1)C(=O)O |
---|
InChI Key | NXSNYMSUGBCBCQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamic acid and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alpha amino acidsamino acidsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshippuric acids and derivativeshydrocarbon derivativesmonosaccharidesn-acyl-alpha amino acidsn-glucuronidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenylalkylaminespyran carboxylic acidssecondary alcoholssecondary alkylarylaminessecondary carboxylic acid amidestricarboxylic acids and derivatives |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundamino acidbenzoylmonosaccharidetricarboxylic acid or derivativespyran carboxylic acidbenzamiden-glucuronidebeta-hydroxy acidsaccharideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholpyran carboxylic acid or derivativesn-acyl-alpha-amino acidhippuric acid or derivativesbenzoic acid or derivativesglutamic acid or derivativeshydroxy acidsecondary aminecarboxamide groupsecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyransecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
---|