| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:32 UTC |
|---|
| Update Date | 2025-03-21 18:00:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025548 |
|---|
| Frequency | 162.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N6O2 |
|---|
| Molecular Mass | 236.1022 |
|---|
| SMILES | CC(O)C(O)c1cnc2nc(N)nc(N)c2n1 |
|---|
| InChI Key | ADPRPNXHOYFHIT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrazinespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholazacycleheteroaromatic compoundpteridinepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound1,2-diol |
|---|