| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:44:32 UTC |
|---|
| Update Date | 2025-03-21 18:00:10 UTC |
|---|
| HMDB ID | HMDB0041905 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025571 |
|---|
| Name | 4-Hydroxyphenytoin |
|---|
| Frequency | 305.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12N2O3 |
|---|
| Molecular Mass | 268.0848 |
|---|
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccc(O)cc2)N1 |
|---|
| InChI Key | XEEDURHPFVXALT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | phenylhydantoins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximidesdiphenylmethaneshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylimidazolidines |
|---|
| Substituents | diphenylmethanemonocyclic benzene moietycarbonyl group5-phenylhydantoinphenylimidazolidinearomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidecarbonic acid derivativeazacycleorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
