| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:44:34 UTC |
|---|
| Update Date | 2025-03-21 18:00:11 UTC |
|---|
| HMDB ID | HMDB0257705 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025657 |
|---|
| Name | 4-Amino-1-[(2R,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
|---|
| Frequency | 150.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N4O4 |
|---|
| Molecular Mass | 242.1015 |
|---|
| SMILES | NCC1OC(n2ccc(N)nc2=O)C(O)C1O |
|---|
| InChI Key | JAPYDVOSULWTRJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxyribonucleosides |
|---|
| Direct Parent | 5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkylaminesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundmonosaccharidepyrimidonepyrimidinesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compound1,2-diolalcohol5'-deoxyribonucleosidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
