| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:37 UTC |
|---|
| Update Date | 2025-03-21 18:00:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00025756 |
|---|
| Frequency | 149.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13N7O |
|---|
| Molecular Mass | 283.1182 |
|---|
| SMILES | COc1ccc(-c2nc3c(N)nc(N)nc3nc2N)cc1 |
|---|
| InChI Key | XXFIGLAYTZCDPY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmethoxybenzenesorganopnictogen compoundsphenoxy compoundsprimary aminespyrazinespyrimidines and pyrimidine derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheralkyl aryl etherpteridinepyrimidinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamazacycleheteroaromatic compoundmethoxybenzeneorganic oxygen compoundanisolepyrazinehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
