Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:44:47 UTC |
---|
Update Date | 2025-03-21 18:00:15 UTC |
---|
HMDB ID | HMDB0041738 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00026147 |
---|
Name | Genistein 5-O-glucuronide |
---|
Frequency | 146.6 |
---|
Structure | |
---|
Chemical Formula | C21H18O11 |
---|
Molecular Mass | 446.0849 |
---|
SMILES | O=C(O)C1OC(Oc2cc(O)cc3occ(-c4ccc(O)cc4)c(=O)c23)C(O)C(O)C1O |
---|
InChI Key | IOJNOBYNWXBNBY-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflavonoid o-glycosides |
---|
Direct Parent | isoflavonoid o-glycosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidschromonesglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesisoflavonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyranones and derivativessecondary alcoholsvinylogous esters |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivatives1-benzopyrano-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundisoflavonealcoholbenzopyranpyran carboxylic acid or derivativesvinylogous esterheteroaromatic compoundisoflavonoid o-glycosidehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidisoflavonoid-5-o-glycosideorganooxygen compound |
---|